C13H13ClN8O7 — CID 134344364
2-[[(2S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]propanedioic acid (PubChem CID 134344364) has the molecular formula C13H13ClN8O7 and a molecular weight of 428.75 g/mol. Its IUPAC name is 2-[[(2S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-[[(2S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 134344364 |
| Molecular Formula | C13H13ClN8O7 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 2-[[(2S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]propanedioic acid |
| SMILES | [N-]=[N+]=NC1[C@@H](O)[C@H](n2cnc3c(N)nc(Cl)nc32)O[C@@H]1COC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H13ClN8O7/c14-13-18-8(15)5-9(19-13)22(2-17-5)10-6(23)4(20-21-16)3(29-10)1-28-7(11(24)25)12(26)27/h2-4,6-7,10,23H,1H2,(H,24,25)(H,26,27)(H2,15,18,19)/t3-,4?,6-,10-/m1/s1 |
| InChIKey | WFKPOZJSVIOBHW-VNLUYBLUSA-N |
| XLogP | -0.45 |
| TPSA | 231.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|