C19H19ClN10O6 — CID 135156716
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-pyridin-3-yl-2-(2H-tetrazol-5-yl)propanoic acid (PubChem CID 135156716) has the molecular formula C19H19ClN10O6 and a molecular weight of 518.88 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-pyridin-3-yl-2-(2H-tetrazol-5-yl)propanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-pyridin-3-yl-2-(2H-tetrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 135156716 |
| Molecular Formula | C19H19ClN10O6 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-pyridin-3-yl-2-(2H-tetrazol-5-yl)propanoic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(Cc2cccnc2)(C(=O)O)c2nn[nH]n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19ClN10O6/c20-18-24-13(21)10-14(25-18)30(7-23-10)15-12(32)11(31)9(36-15)6-35-19(17(33)34,16-26-28-29-27-16)4-8-2-1-3-22-5-8/h1-3,5,7,9,11-12,15,31-32H,4,6H2,(H,33,34)(H2,21,24,25)(H,26,27,28,29)/t9-,11-,12-,15-,19?/m1/s1 |
| InChIKey | AOVZQHDMNFKFFE-REUWOWEOSA-N |
| XLogP | -1.17 |
| TPSA | 233.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |