C22H20ClN9O6 — CID 146276648
(2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid (PubChem CID 146276648) has the molecular formula C22H20ClN9O6 and a molecular weight of 541.91 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 146276648 |
| Molecular Formula | C22H20ClN9O6 |
| Molecular Weight | 541.91 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](CO[C@](Cc2ccccc2)(C(=O)O)c2nn[nH]n2)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C22H20ClN9O6/c1-2-21(36)12(38-17(14(21)33)32-10-25-13-15(24)26-20(23)27-16(13)32)9-37-22(19(34)35,18-28-30-31-29-18)8-11-6-4-3-5-7-11/h1,3-7,10,12,14,17,33,36H,8-9H2,(H,34,35)(H2,24,26,27)(H,28,29,30,31)/t12-,14+,17-,21-,22+/m1/s1 |
| InChIKey | LNSXHIWMMNCMQE-PBJFIIPLSA-N |
| XLogP | -0.56 |
| TPSA | 220.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.91 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|