C27H24ClN7O8 — CID 146282760
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-amino-3-pyridinyl)phenyl]methyl]propanedioic acid (PubChem CID 146282760) has the molecular formula C27H24ClN7O8 and a molecular weight of 609.98 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-amino-3-pyridinyl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-amino-3-pyridinyl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 146282760 |
| Molecular Formula | C27H24ClN7O8 |
| Molecular Weight | 609.98 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-amino-3-pyridinyl)phenyl]methyl]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccc(-c3cccnc3N)cc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C27H24ClN7O8/c1-2-26(41)16(43-22(18(26)36)35-12-32-17-20(30)33-25(28)34-21(17)35)11-42-27(23(37)38,24(39)40)10-13-5-7-14(8-6-13)15-4-3-9-31-19(15)29/h1,3-9,12,16,18,22,36,41H,10-11H2,(H2,29,31)(H,37,38)(H,39,40)(H2,30,33,34)/t16-,18+,22-,26-/m1/s1 |
| InChIKey | DCLLEOQAEJMRAX-OVJZRAFVSA-N |
| XLogP | 0.50 |
| TPSA | 242.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.98 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|