C31H28ClN5O8 — CID 146276819
2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid (PubChem CID 146276819) has the molecular formula C31H28ClN5O8 and a molecular weight of 634.05 g/mol. Its IUPAC name is 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 146276819 |
| Molecular Formula | C31H28ClN5O8 |
| Molecular Weight | 634.05 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N[C@H]4CCc5ccccc54)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C31H28ClN5O8/c1-2-30(43)21(15-44-31(27(39)40,28(41)42)14-17-8-4-3-5-9-17)45-26(23(30)38)37-16-33-22-24(35-29(32)36-25(22)37)34-20-13-12-18-10-6-7-11-19(18)20/h1,3-11,16,20-21,23,26,38,43H,12-15H2,(H,39,40)(H,41,42)(H,34,35,36)/t20-,21+,23-,26+,30+/m0/s1 |
| InChIKey | PSJZBBCOMSHGIY-ULDRQFMZSA-N |
| XLogP | 2.37 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.05 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|