C31H29ClN4O6 — CID 159580774
2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid (PubChem CID 159580774) has the molecular formula C31H29ClN4O6 and a molecular weight of 589.05 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 159580774 |
| Molecular Formula | C31H29ClN4O6 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)C(=O)O)O[C@@H](n2cnc3c(C[C@H]4CCc5ccccc54)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C31H29ClN4O6/c1-2-31(40)24(16-41-23(29(38)39)14-18-8-4-3-5-9-18)42-28(26(31)37)36-17-33-25-22(34-30(32)35-27(25)36)15-20-13-12-19-10-6-7-11-21(19)20/h1,3-11,17,20,23-24,26,28,37,40H,12-16H2,(H,38,39)/t20-,23?,24-,26+,28-,31-/m1/s1 |
| InChIKey | BGSJXDBGMZFBIB-CBYMRIBMSA-N |
| XLogP | 3.09 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|