C26H28ClN5O7 — CID 153300986
2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid (PubChem CID 153300986) has the molecular formula C26H28ClN5O7 and a molecular weight of 557.99 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 153300986 |
| Molecular Formula | C26H28ClN5O7 |
| Molecular Weight | 557.99 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)C(=O)O)O[C@@H](n2cnc3c(N4CC[C@H](CO)C4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C26H28ClN5O7/c1-2-26(37)18(13-38-17(24(35)36)10-15-6-4-3-5-7-15)39-23(20(26)34)32-14-28-19-21(29-25(27)30-22(19)32)31-9-8-16(11-31)12-33/h1,3-7,14,16-18,20,23,33-34,37H,8-13H2,(H,35,36)/t16-,17?,18+,20-,23+,26+/m0/s1 |
| InChIKey | SRUUJMJOCZPDEM-INBDZUSUSA-N |
| XLogP | 0.63 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.99 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|