C16H17ClN6O7 — CID 146282726
3-amino-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid (PubChem CID 146282726) has the molecular formula C16H17ClN6O7 and a molecular weight of 440.80 g/mol. Its IUPAC name is 3-amino-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-amino-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 146282726 |
| Molecular Formula | C16H17ClN6O7 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 3-amino-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(C(N)=O)C(=O)O)O[C@@H](n2cnc3c(NC)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C16H17ClN6O7/c1-3-16(28)6(4-29-8(10(18)25)14(26)27)30-13(9(16)24)23-5-20-7-11(19-2)21-15(17)22-12(7)23/h1,5-6,8-9,13,24,28H,4H2,2H3,(H2,18,25)(H,26,27)(H,19,21,22)/t6-,8?,9+,13-,16-/m1/s1 |
| InChIKey | PUGLDJGZMOUANQ-RPCTZZOOSA-N |
| XLogP | -1.90 |
| TPSA | 194.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|