C28H25ClN6O9 — CID 162533506
2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxo-3H-pyridin-3-yl)phenyl]methyl]propanedioic acid (PubChem CID 162533506) has the molecular formula C28H25ClN6O9 and a molecular weight of 624.99 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxo-3H-pyridin-3-yl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxo-3H-pyridin-3-yl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 162533506 |
| Molecular Formula | C28H25ClN6O9 |
| Molecular Weight | 624.99 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxo-3H-pyridin-3-yl)phenyl]methyl]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccc(C3C=CC=NC3=O)cc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(NC)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C28H25ClN6O9/c1-3-27(42)17(44-23(19(27)36)35-13-32-18-20(30-2)33-26(29)34-21(18)35)12-43-28(24(38)39,25(40)41)11-14-6-8-15(9-7-14)16-5-4-10-31-22(16)37/h1,4-10,13,16-17,19,23,36,42H,11-12H2,2H3,(H,38,39)(H,40,41)(H,30,33,34)/t16?,17-,19+,23-,27-/m1/s1 |
| InChIKey | GUSAOPYAXRHXOD-GYVLOQEJSA-N |
| XLogP | 0.56 |
| TPSA | 218.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.99 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|