C30H29ClN6O8 — CID 146276582
2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-4-ylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-ethoxy-3-oxopropanoic acid (PubChem CID 146276582) has the molecular formula C30H29ClN6O8 and a molecular weight of 637.05 g/mol. Its IUPAC name is 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-4-ylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-ethoxy-3-oxopropanoic acid.
| Compound Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-4-ylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-ethoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 146276582 |
| Molecular Formula | C30H29ClN6O8 |
| Molecular Weight | 637.05 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-4-ylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-ethoxy-3-oxopropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)OCC)O[C@@H](n2cnc3c(NCc4ccncc4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C30H29ClN6O8/c1-3-29(42)20(16-44-30(26(39)40,27(41)43-4-2)14-18-8-6-5-7-9-18)45-25(22(29)38)37-17-34-21-23(35-28(31)36-24(21)37)33-15-19-10-12-32-13-11-19/h1,5-13,17,20,22,25,38,42H,4,14-16H2,2H3,(H,39,40)(H,33,35,36)/t20-,22+,25-,29-,30?/m1/s1 |
| InChIKey | IXBSBQSUFHKOBZ-SHAVVNPOSA-N |
| XLogP | 1.76 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.05 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|