C27H28N6O8 — CID 146276545
diethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate (PubChem CID 146276545) has the molecular formula C27H28N6O8 and a molecular weight of 564.56 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate |
|---|---|
| PubChem CID | 146276545 |
| Molecular Formula | C27H28N6O8 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)OCC)C(=O)OCC)O[C@@H](n2cnc3c(N)nc(C#N)nc32)[C@@H]1O |
| InChI | InChI=1S/C27H28N6O8/c1-4-26(37)17(41-23(20(26)34)33-15-30-19-21(29)31-18(13-28)32-22(19)33)14-40-27(24(35)38-5-2,25(36)39-6-3)12-16-10-8-7-9-11-16/h1,7-11,15,17,20,23,34,37H,5-6,12,14H2,2-3H3,(H2,29,31,32)/t17-,20+,23-,26-/m1/s1 |
| InChIKey | GIMPJWMHHRYKIH-WKDZWADYSA-N |
| XLogP | 0.03 |
| TPSA | 204.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|