C30H32ClN5O11 — CID 146276659
diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(hydroxyamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioate (PubChem CID 146276659) has the molecular formula C30H32ClN5O11 and a molecular weight of 674.06 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(hydroxyamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(hydroxyamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioate |
|---|---|
| PubChem CID | 146276659 |
| Molecular Formula | C30H32ClN5O11 |
| Molecular Weight | 674.06 g/mol |
| Exact Mass | 673.18 |
| IUPAC Name | diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(hydroxyamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(Cc2ccccc2)(C(=O)OCC)C(=O)OCC)O[C@@H](n2cnc3c(NO)nc(Cl)nc32)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H32ClN5O11/c1-6-29(47-18(5)38)20(15-44-30(26(39)42-7-2,27(40)43-8-3)14-19-12-10-9-11-13-19)46-25(22(29)45-17(4)37)36-16-32-21-23(35-41)33-28(31)34-24(21)36/h1,9-13,16,20,22,25,41H,7-8,14-15H2,2-5H3,(H,33,34,35)/t20-,22+,25-,29-/m1/s1 |
| InChIKey | KOCAJASPNVDQII-RYVXYRFYSA-N |
| XLogP | 2.17 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|