C28H28Cl2N4O8 — CID 153379371
ethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methyl-3-phenylpropanoate (PubChem CID 153379371) has the molecular formula C28H28Cl2N4O8 and a molecular weight of 619.46 g/mol. Its IUPAC name is ethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 153379371 |
| Molecular Formula | C28H28Cl2N4O8 |
| Molecular Weight | 619.46 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | ethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methyl-3-phenylpropanoate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(C)(Cc2ccccc2)C(=O)OCC)O[C@@H](n2cnc3c(Cl)nc(Cl)nc32)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H28Cl2N4O8/c1-6-28(42-17(4)36)19(14-39-27(5,25(37)38-7-2)13-18-11-9-8-10-12-18)41-24(21(28)40-16(3)35)34-15-31-20-22(29)32-26(30)33-23(20)34/h1,8-12,15,19,21,24H,7,13-14H2,2-5H3/t19-,21+,24-,27?,28-/m1/s1 |
| InChIKey | KQROGXKBLJANIK-SOEBTTKHSA-N |
| XLogP | 3.48 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|