C34H40ClN3O10Si — CID 151512036
diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3-(2-trimethylsilylethynyl)oxolan-2-yl]methoxy]propanedioate (PubChem CID 151512036) has the molecular formula C34H40ClN3O10Si and a molecular weight of 714.24 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3-(2-trimethylsilylethynyl)oxolan-2-yl]methoxy]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3-(2-trimethylsilylethynyl)oxolan-2-yl]methoxy]propanedioate |
|---|---|
| PubChem CID | 151512036 |
| Molecular Formula | C34H40ClN3O10Si |
| Molecular Weight | 714.24 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | diethyl 2-benzyl-2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-chloroimidazo[4,5-b]pyridin-3-yl)-3-(2-trimethylsilylethynyl)oxolan-2-yl]methoxy]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(OC[C@H]1O[C@@H](n2cnc3ccc(Cl)nc32)[C@H](OC(C)=O)[C@]1(C#C[Si](C)(C)C)OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C34H40ClN3O10Si/c1-8-43-31(41)34(32(42)44-9-2,19-24-13-11-10-12-14-24)45-20-26-33(48-23(4)40,17-18-49(5,6)7)28(46-22(3)39)30(47-26)38-21-36-25-15-16-27(35)37-29(25)38/h10-16,21,26,28,30H,8-9,19-20H2,1-7H3/t26-,28+,30-,33-/m1/s1 |
| InChIKey | PSRCWHIXPPDOFY-VSZRMKPRSA-N |
| XLogP | 4.22 |
| TPSA | 154.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|