C30H34ClN5O11S — CID 146276707
diethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(2-hydroxyethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-2-(thiophen-3-ylmethyl)propanedioate (PubChem CID 146276707) has the molecular formula C30H34ClN5O11S and a molecular weight of 708.15 g/mol. Its IUPAC name is diethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(2-hydroxyethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-2-(thiophen-3-ylmethyl)propanedioate.
| Compound Name | diethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(2-hydroxyethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-2-(thiophen-3-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 146276707 |
| Molecular Formula | C30H34ClN5O11S |
| Molecular Weight | 708.15 g/mol |
| Exact Mass | 707.17 |
| IUPAC Name | diethyl 2-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-chloro-6-(2-hydroxyethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]-2-(thiophen-3-ylmethyl)propanedioate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(Cc2ccsc2)(C(=O)OCC)C(=O)OCC)O[C@@H](n2cnc3c(NCCO)nc(Cl)nc32)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H34ClN5O11S/c1-6-29(47-18(5)39)20(14-44-30(26(40)42-7-2,27(41)43-8-3)13-19-9-12-48-15-19)46-25(22(29)45-17(4)38)36-16-33-21-23(32-10-11-37)34-28(31)35-24(21)36/h1,9,12,15-16,20,22,25,37H,7-8,10-11,13-14H2,2-5H3,(H,32,34,35)/t20-,22+,25-,29-/m1/s1 |
| InChIKey | VWXIQPRBFPVAEV-RYVXYRFYSA-N |
| XLogP | 1.83 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|