C25H32O9 — CID 160824899
ethyl 2-benzyl-2-[[(2S,3S,4R)-4,5-diacetyloxy-3-ethenyl-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate (PubChem CID 160824899) has the molecular formula C25H32O9 and a molecular weight of 476.52 g/mol. Its IUPAC name is ethyl 2-benzyl-2-[[(2S,3S,4R)-4,5-diacetyloxy-3-ethenyl-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate.
| Compound Name | ethyl 2-benzyl-2-[[(2S,3S,4R)-4,5-diacetyloxy-3-ethenyl-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate |
|---|---|
| PubChem CID | 160824899 |
| Molecular Formula | C25H32O9 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | ethyl 2-benzyl-2-[[(2S,3S,4R)-4,5-diacetyloxy-3-ethenyl-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate |
| SMILES | C=C[C@@]1(C)[C@@H](COC(Cc2ccccc2)(C(C)=O)C(=O)OCC)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H32O9/c1-7-24(6)20(34-22(33-18(5)28)21(24)32-17(4)27)15-31-25(16(3)26,23(29)30-8-2)14-19-12-10-9-11-13-19/h7,9-13,20-22H,1,8,14-15H2,2-6H3/t20-,21+,22?,24+,25?/m1/s1 |
| InChIKey | QYDJVEVWQVVOAM-MZXLBGBDSA-N |
| XLogP | 2.55 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|