C22H28O9 — CID 171573846
diethyl 2-benzyl-2-[[(2S,3S,4R)-3,4,5-trihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]propanedioate (PubChem CID 171573846) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[[(2S,3S,4R)-3,4,5-trihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[[(2S,3S,4R)-3,4,5-trihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]propanedioate |
|---|---|
| PubChem CID | 171573846 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | diethyl 2-benzyl-2-[[(2S,3S,4R)-3,4,5-trihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]propanedioate |
| SMILES | CC#C[C@@]1(O)[C@H](COC(Cc2ccccc2)(C(=O)OCC)C(=O)OCC)OC(O)[C@@H]1O |
| InChI | InChI=1S/C22H28O9/c1-4-12-21(27)16(31-18(24)17(21)23)14-30-22(19(25)28-5-2,20(26)29-6-3)13-15-10-8-7-9-11-15/h7-11,16-18,23-24,27H,5-6,13-14H2,1-3H3/t16-,17-,18?,21+/m0/s1 |
| InChIKey | VGDDSRZVVAUTHR-HJRJXYFPSA-N |
| XLogP | -0.06 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|