C20H25NO9 — CID 146276717
diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-(pyridin-4-ylmethyl)propanedioate (PubChem CID 146276717) has the molecular formula C20H25NO9 and a molecular weight of 423.42 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-(pyridin-4-ylmethyl)propanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-(pyridin-4-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 146276717 |
| Molecular Formula | C20H25NO9 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R)-3-ethynyl-3,4,5-trihydroxyoxolan-2-yl]methoxy]-2-(pyridin-4-ylmethyl)propanedioate |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccncc2)(C(=O)OCC)C(=O)OCC)OC(O)[C@@H]1O |
| InChI | InChI=1S/C20H25NO9/c1-4-19(26)14(30-16(23)15(19)22)12-29-20(17(24)27-5-2,18(25)28-6-3)11-13-7-9-21-10-8-13/h1,7-10,14-16,22-23,26H,5-6,11-12H2,2-3H3/t14-,15+,16?,19-/m1/s1 |
| InChIKey | PLLOKHOQDFDGMS-QDXKRRSBSA-N |
| XLogP | -1.05 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|