C29H36N2O11 — CID 146282564
diethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioate (PubChem CID 146282564) has the molecular formula C29H36N2O11 and a molecular weight of 588.61 g/mol. Its IUPAC name is diethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 146282564 |
| Molecular Formula | C29H36N2O11 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | diethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(2-oxo-1,3-diazinan-1-yl)phenyl]methyl]propanedioate |
| SMILES | C#C[C@]1(OC(C)=O)[C@@H](OC(C)=O)CO[C@@H]1COC(Cc1ccc(N2CCCNC2=O)cc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C29H36N2O11/c1-6-28(42-20(5)33)23(39-17-24(28)41-19(4)32)18-40-29(25(34)37-7-2,26(35)38-8-3)16-21-10-12-22(13-11-21)31-15-9-14-30-27(31)36/h1,10-13,23-24H,7-9,14-18H2,2-5H3,(H,30,36)/t23-,24+,28-/m1/s1 |
| InChIKey | ITSBTLLMTIEFAJ-FMGHJNRGSA-N |
| XLogP | 1.30 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|