C25H29NO11 — CID 146276688
methyl 2-benzyl-3-(methylamino)-3-oxo-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanoate (PubChem CID 146276688) has the molecular formula C25H29NO11 and a molecular weight of 519.50 g/mol. Its IUPAC name is methyl 2-benzyl-3-(methylamino)-3-oxo-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanoate.
| Compound Name | methyl 2-benzyl-3-(methylamino)-3-oxo-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanoate |
|---|---|
| PubChem CID | 146276688 |
| Molecular Formula | C25H29NO11 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | methyl 2-benzyl-3-(methylamino)-3-oxo-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanoate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(Cc2ccccc2)(C(=O)NC)C(=O)OC)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H29NO11/c1-7-24(37-17(4)29)19(36-21(35-16(3)28)20(24)34-15(2)27)14-33-25(22(30)26-5,23(31)32-6)13-18-11-9-8-10-12-18/h1,8-12,19-21H,13-14H2,2-6H3,(H,26,30)/t19-,20+,21?,24-,25?/m1/s1 |
| InChIKey | ZGNCYWDLEPMSFW-OFYOEXEISA-N |
| XLogP | 0.06 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|