C25H27NO8S — CID 146282756
ethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoate (PubChem CID 146282756) has the molecular formula C25H27NO8S and a molecular weight of 501.56 g/mol. Its IUPAC name is ethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoate.
| Compound Name | ethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoate |
|---|---|
| PubChem CID | 146282756 |
| Molecular Formula | C25H27NO8S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | ethyl 2-[[(2R,3R,4S)-3,4-diacetyloxy-3-ethynyloxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoate |
| SMILES | C#C[C@]1(OC(C)=O)[C@@H](OC(C)=O)CO[C@@H]1COC(Cc1ccccc1)(C(=O)OCC)c1cscn1 |
| InChI | InChI=1S/C25H27NO8S/c1-5-24(34-18(4)28)21(31-13-22(24)33-17(3)27)14-32-25(23(29)30-6-2,20-15-35-16-26-20)12-19-10-8-7-9-11-19/h1,7-11,15-16,21-22H,6,12-14H2,2-4H3/t21-,22+,24-,25?/m1/s1 |
| InChIKey | ALACTKUEVWPADX-LIAIWUSBSA-N |
| XLogP | 2.43 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|