C30H39NO12 — CID 146276868
diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-ethynyl-4,5-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-ethoxycarbonylpyrrolidin-1-yl)phenyl]methyl]propanedioate (PubChem CID 146276868) has the molecular formula C30H39NO12 and a molecular weight of 605.64 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-ethynyl-4,5-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-ethoxycarbonylpyrrolidin-1-yl)phenyl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-ethynyl-4,5-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-ethoxycarbonylpyrrolidin-1-yl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 146276868 |
| Molecular Formula | C30H39NO12 |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-ethynyl-4,5-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-ethoxycarbonylpyrrolidin-1-yl)phenyl]methyl]propanedioate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(Cc2ccc(N3CCCC3C(=O)OCC)cc2)(C(=O)OCC)C(=O)OCC)OC(O)[C@@H]1O |
| InChI | InChI=1S/C30H39NO12/c1-6-29(43-19(5)32)23(42-26(35)24(29)33)18-41-30(27(36)39-8-3,28(37)40-9-4)17-20-12-14-21(15-13-20)31-16-10-11-22(31)25(34)38-7-2/h1,12-15,22-24,26,33,35H,7-11,16-18H2,2-5H3/t22?,23-,24+,26?,29-/m1/s1 |
| InChIKey | BAAWUNULYIJYPV-NFTHGRRBSA-N |
| XLogP | 0.66 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|