C35H46N6O8 — CID 153379273
ethyl 1-[4-[2-[[5-(6-amino-2-methylpurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-3-ethoxy-2-formyl-3-oxopropyl]phenyl]pyrrolidine-2-carboxylate;methoxyethane (PubChem CID 153379273) has the molecular formula C35H46N6O8 and a molecular weight of 678.79 g/mol. Its IUPAC name is ethyl 1-[4-[2-[[5-(6-amino-2-methylpurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-3-ethoxy-2-formyl-3-oxopropyl]phenyl]pyrrolidine-2-carboxylate;methoxyethane.
| Compound Name | ethyl 1-[4-[2-[[5-(6-amino-2-methylpurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-3-ethoxy-2-formyl-3-oxopropyl]phenyl]pyrrolidine-2-carboxylate;methoxyethane |
|---|---|
| PubChem CID | 153379273 |
| Molecular Formula | C35H46N6O8 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | ethyl 1-[4-[2-[[5-(6-amino-2-methylpurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-3-ethoxy-2-formyl-3-oxopropyl]phenyl]pyrrolidine-2-carboxylate;methoxyethane |
| SMILES | C#CC1CC(n2cnc3c(N)nc(C)nc32)OC1COC(C=O)(Cc1ccc(N2CCCC2C(=O)OCC)cc1)C(=O)OCC.CCOC |
| InChI | InChI=1S/C32H38N6O7.C3H8O/c1-5-22-15-26(38-19-34-27-28(33)35-20(4)36-29(27)38)45-25(22)17-44-32(18-39,31(41)43-7-3)16-21-10-12-23(13-11-21)37-14-8-9-24(37)30(40)42-6-2;1-3-4-2/h1,10-13,18-19,22,24-26H,6-9,14-17H2,2-4H3,(H2,33,35,36);3H2,1-2H3 |
| InChIKey | FOUQJYRHYOOOMB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 170.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|