C27H28ClN7O7 — CID 146282733
2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl]propanedioic acid (PubChem CID 146282733) has the molecular formula C27H28ClN7O7 and a molecular weight of 598.02 g/mol. Its IUPAC name is 2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 146282733 |
| Molecular Formula | C27H28ClN7O7 |
| Molecular Weight | 598.02 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-[[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]methyl]propanedioic acid |
| SMILES | C#C[C@@H]1C[C@H](n2cnc3c(N)nc(Cl)nc32)O[C@@H]1COC(Cc1ccc(N2CCN(C)CC2=O)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H28ClN7O7/c1-3-16-10-20(35-14-30-21-22(29)31-26(28)32-23(21)35)42-18(16)13-41-27(24(37)38,25(39)40)11-15-4-6-17(7-5-15)34-9-8-33(2)12-19(34)36/h1,4-7,14,16,18,20H,8-13H2,2H3,(H,37,38)(H,39,40)(H2,29,31,32)/t16-,18-,20-/m1/s1 |
| InChIKey | ALWQLFZMTRDLDJ-YVWKXTFCSA-N |
| XLogP | 1.04 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.02 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|