C26H26ClN5O7 — CID 153379187
2-benzyl-2-[[5-[2-chloro-6-(3-hydroxypyrrolidin-1-yl)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid (PubChem CID 153379187) has the molecular formula C26H26ClN5O7 and a molecular weight of 555.98 g/mol. Its IUPAC name is 2-benzyl-2-[[5-[2-chloro-6-(3-hydroxypyrrolidin-1-yl)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-benzyl-2-[[5-[2-chloro-6-(3-hydroxypyrrolidin-1-yl)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 153379187 |
| Molecular Formula | C26H26ClN5O7 |
| Molecular Weight | 555.98 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 2-benzyl-2-[[5-[2-chloro-6-(3-hydroxypyrrolidin-1-yl)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C#CC1CC(n2cnc3c(N4CCC(O)C4)nc(Cl)nc32)OC1COC(Cc1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H26ClN5O7/c1-2-16-10-19(32-14-28-20-21(29-25(27)30-22(20)32)31-9-8-17(33)12-31)39-18(16)13-38-26(23(34)35,24(36)37)11-15-6-4-3-5-7-15/h1,3-7,14,16-19,33H,8-13H2,(H,34,35)(H,36,37) |
| InChIKey | BDSQWDOWMTYYQV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.98 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|