C16H16ClN5O6 — CID 153379529
2-[[5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methylpropanedioic acid (PubChem CID 153379529) has the molecular formula C16H16ClN5O6 and a molecular weight of 409.79 g/mol. Its IUPAC name is 2-[[5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methylpropanedioic acid.
| Compound Name | 2-[[5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 153379529 |
| Molecular Formula | C16H16ClN5O6 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[[5-(6-amino-2-chloropurin-9-yl)-3-ethynyloxolan-2-yl]methoxy]-2-methylpropanedioic acid |
| SMILES | C#CC1CC(n2cnc3c(N)nc(Cl)nc32)OC1COC(C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H16ClN5O6/c1-3-7-4-9(22-6-19-10-11(18)20-15(17)21-12(10)22)28-8(7)5-27-16(2,13(23)24)14(25)26/h1,6-9H,4-5H2,2H3,(H,23,24)(H,25,26)(H2,18,20,21) |
| InChIKey | MCTPXOXPJFGGAY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|