C26H26ClN5O6 — CID 153379498
2-benzyl-2-[[5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid (PubChem CID 153379498) has the molecular formula C26H26ClN5O6 and a molecular weight of 539.98 g/mol. Its IUPAC name is 2-benzyl-2-[[5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-benzyl-2-[[5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 153379498 |
| Molecular Formula | C26H26ClN5O6 |
| Molecular Weight | 539.98 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-benzyl-2-[[5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C#CC1CC(n2cnc3c(NCC4CC4)nc(Cl)nc32)OC1COC(Cc1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H26ClN5O6/c1-2-17-10-19(32-14-29-20-21(28-12-16-8-9-16)30-25(27)31-22(20)32)38-18(17)13-37-26(23(33)34,24(35)36)11-15-6-4-3-5-7-15/h1,3-7,14,16-19H,8-13H2,(H,33,34)(H,35,36)(H,28,30,31) |
| InChIKey | KZNCLUDZECZSNC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.98 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|