C27H28ClN5O6 — CID 153379442
2-benzyl-2-[[5-[2-chloro-6-[cyclopropylmethyl(methyl)amino]purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid (PubChem CID 153379442) has the molecular formula C27H28ClN5O6 and a molecular weight of 554.00 g/mol. Its IUPAC name is 2-benzyl-2-[[5-[2-chloro-6-[cyclopropylmethyl(methyl)amino]purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-benzyl-2-[[5-[2-chloro-6-[cyclopropylmethyl(methyl)amino]purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 153379442 |
| Molecular Formula | C27H28ClN5O6 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-benzyl-2-[[5-[2-chloro-6-[cyclopropylmethyl(methyl)amino]purin-9-yl]-3-ethynyloxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C#CC1CC(n2cnc3c(N(C)CC4CC4)nc(Cl)nc32)OC1COC(Cc1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H28ClN5O6/c1-3-18-11-20(33-15-29-21-22(30-26(28)31-23(21)33)32(2)13-17-9-10-17)39-19(18)14-38-27(24(34)35,25(36)37)12-16-7-5-4-6-8-16/h1,4-8,15,17-20H,9-14H2,2H3,(H,34,35)(H,36,37) |
| InChIKey | BAPSTCMZQGNHCJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|