C21H22ClN5O6 — CID 135182674
2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid (PubChem CID 135182674) has the molecular formula C21H22ClN5O6 and a molecular weight of 475.89 g/mol. Its IUPAC name is 2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid.
| Compound Name | 2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
|---|---|
| PubChem CID | 135182674 |
| Molecular Formula | C21H22ClN5O6 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 2-[[(2S,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
| SMILES | C[C@H]1C[C@H](n2cnc3c(N)nc(Cl)nc32)O[C@@H]1COC(Cc1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H22ClN5O6/c1-11-7-14(27-10-24-15-16(23)25-20(22)26-17(15)27)33-13(11)9-32-21(18(28)29,19(30)31)8-12-5-3-2-4-6-12/h2-6,10-11,13-14H,7-9H2,1H3,(H,28,29)(H,30,31)(H2,23,25,26)/t11-,13+,14+/m0/s1 |
| InChIKey | QWALYBWQCXNPPH-IACUBPJLSA-N |
| XLogP | 2.15 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|