C24H21ClFN5O7 — CID 142302785
2-[[(2R,3R,4S)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(naphthalen-2-ylmethyl)propanedioic acid (PubChem CID 142302785) has the molecular formula C24H21ClFN5O7 and a molecular weight of 545.91 g/mol. Its IUPAC name is 2-[[(2R,3R,4S)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(naphthalen-2-ylmethyl)propanedioic acid.
| Compound Name | 2-[[(2R,3R,4S)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(naphthalen-2-ylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 142302785 |
| Molecular Formula | C24H21ClFN5O7 |
| Molecular Weight | 545.91 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 2-[[(2R,3R,4S)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(naphthalen-2-ylmethyl)propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1O[C@H](COC(Cc2ccc3ccccc3c2)(C(=O)O)C(=O)O)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C24H21ClFN5O7/c25-23-29-18(27)16-19(30-23)31(10-28-16)20-15(26)17(32)14(38-20)9-37-24(21(33)34,22(35)36)8-11-5-6-12-3-1-2-4-13(12)7-11/h1-7,10,14-15,17,20,32H,8-9H2,(H,33,34)(H,35,36)(H2,27,29,30)/t14-,15+,17-,20?/m1/s1 |
| InChIKey | UUBPIDKCVAKRAV-XMLKIIPHSA-N |
| XLogP | 1.98 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.91 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|