C17H19ClFN6O5P — CID 118541644
[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid (PubChem CID 118541644) has the molecular formula C17H19ClFN6O5P and a molecular weight of 472.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid.
| Compound Name | [(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid |
|---|---|
| PubChem CID | 118541644 |
| Molecular Formula | C17H19ClFN6O5P |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)NCc2ccccc2)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C17H19ClFN6O5P/c18-17-23-14(20)12-15(24-17)25(8-21-12)16-11(19)13(26)10(30-16)7-29-31(27,28)22-6-9-4-2-1-3-5-9/h1-5,8,10-11,13,16,26H,6-7H2,(H2,20,23,24)(H2,22,27,28)/t10-,11+,13-,16-/m1/s1 |
| InChIKey | WFFPYODYBSPRTR-DDFXLWFNSA-N |
| XLogP | 1.57 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|