C22H22ClFN7O8P — CID 129033308
(2R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-[[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxymethyl]-4-fluorooxolan-3-ol (PubChem CID 129033308) has the molecular formula C22H22ClFN7O8P and a molecular weight of 597.88 g/mol. Its IUPAC name is (2R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-[[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxymethyl]-4-fluorooxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-[[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxymethyl]-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 129033308 |
| Molecular Formula | C22H22ClFN7O8P |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | (2R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-[[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxymethyl]-4-fluorooxolan-3-ol |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(NCc2ccccc2)OCc2ccc([N+](=O)[O-])o2)C(O)C1F |
| InChI | InChI=1S/C22H22ClFN7O8P/c23-22-28-19(25)17-20(29-22)30(11-26-17)21-16(24)18(32)14(39-21)10-37-40(35,27-8-12-4-2-1-3-5-12)36-9-13-6-7-15(38-13)31(33)34/h1-7,11,14,16,18,21,32H,8-10H2,(H,27,35)(H2,25,28,29)/t14-,16?,18?,21-,40?/m1/s1 |
| InChIKey | LONQDRVCKNPOOP-IBYWVVJKSA-N |
| XLogP | 3.29 |
| TPSA | 202.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|