C22H25FN7O9P — CID 129033303
(2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol (PubChem CID 129033303) has the molecular formula C22H25FN7O9P and a molecular weight of 581.45 g/mol. Its IUPAC name is (2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol.
| Compound Name | (2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol |
|---|---|
| PubChem CID | 129033303 |
| Molecular Formula | C22H25FN7O9P |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | (2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol |
| SMILES | Nc1nc(F)nc2c1ncn2CO[C@H](COP(=O)(NCc1ccccc1)OCc1ccc([N+](=O)[O-])o1)[C@H](O)CO |
| InChI | InChI=1S/C22H25FN7O9P/c23-22-27-20(24)19-21(28-22)29(12-25-19)13-36-17(16(32)9-31)11-38-40(35,26-8-14-4-2-1-3-5-14)37-10-15-6-7-18(39-15)30(33)34/h1-7,12,16-17,31-32H,8-11,13H2,(H,26,35)(H2,24,27,28)/t16-,17-,40?/m1/s1 |
| InChIKey | NKAKSMYQWJSQHW-ATFCGDBOSA-N |
| XLogP | 1.88 |
| TPSA | 223.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|