C27H34N8O8 — CID 71160321
(4-nitrophenyl)methyl 4-[[6-amino-9-[[(2S,3R)-1-(cyclopropylamino)-3,4-dihydroxy-1-oxobutan-2-yl]oxymethyl]purin-2-yl]methyl]piperidine-1-carboxylate (PubChem CID 71160321) has the molecular formula C27H34N8O8 and a molecular weight of 598.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[[6-amino-9-[[(2S,3R)-1-(cyclopropylamino)-3,4-dihydroxy-1-oxobutan-2-yl]oxymethyl]purin-2-yl]methyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-[[6-amino-9-[[(2S,3R)-1-(cyclopropylamino)-3,4-dihydroxy-1-oxobutan-2-yl]oxymethyl]purin-2-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71160321 |
| Molecular Formula | C27H34N8O8 |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[[6-amino-9-[[(2S,3R)-1-(cyclopropylamino)-3,4-dihydroxy-1-oxobutan-2-yl]oxymethyl]purin-2-yl]methyl]piperidine-1-carboxylate |
| SMILES | Nc1nc(CC2CCN(C(=O)OCc3ccc([N+](=O)[O-])cc3)CC2)nc2c1ncn2CO[C@H](C(=O)NC1CC1)[C@H](O)CO |
| InChI | InChI=1S/C27H34N8O8/c28-24-22-25(34(14-29-22)15-43-23(20(37)12-36)26(38)30-18-3-4-18)32-21(31-24)11-16-7-9-33(10-8-16)27(39)42-13-17-1-5-19(6-2-17)35(40)41/h1-2,5-6,14,16,18,20,23,36-37H,3-4,7-13,15H2,(H,30,38)(H2,28,31,32)/t20-,23+/m1/s1 |
| InChIKey | GGLBPLJUWCWMPX-OFNKIYASSA-N |
| XLogP | 0.88 |
| TPSA | 221.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|