C18H18FN7O5 — CID 24805388
(4-nitrophenyl)methyl (2R,4S)-4-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 24805388) has the molecular formula C18H18FN7O5 and a molecular weight of 431.38 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-4-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-4-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24805388 |
| Molecular Formula | C18H18FN7O5 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-4-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | Nc1nc(F)nc2c1ncn2[C@H]1C[C@H](CO)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H18FN7O5/c19-17-22-15(20)14-16(23-17)25(9-21-14)12-5-13(7-27)24(6-12)18(28)31-8-10-1-3-11(4-2-10)26(29)30/h1-4,9,12-13,27H,5-8H2,(H2,20,22,23)/t12-,13+/m0/s1 |
| InChIKey | ISSWRFQPYAXIQP-QWHCGFSZSA-N |
| XLogP | 1.40 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|