C21H24N2O6S — CID 151341441
(4-nitrophenyl)methyl (2S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 151341441) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151341441 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CSC2C[C@@H](CO)N(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-28-19-8-4-16(5-9-19)14-30-20-10-18(12-24)22(11-20)21(25)29-13-15-2-6-17(7-3-15)23(26)27/h2-9,18,20,24H,10-14H2,1H3/t18-,20?/m0/s1 |
| InChIKey | OKOHRFCJXQLUQK-LROBGIAVSA-N |
| XLogP | 3.61 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|