C26H32N4O6S — CID 10626012
(4-nitrophenyl)methyl 4-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 10626012) has the molecular formula C26H32N4O6S and a molecular weight of 528.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10626012 |
| Molecular Formula | C26H32N4O6S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CS[C@H]2C[C@@H](C(=O)N3CCN(C(=O)OCc4ccc([N+](=O)[O-])cc4)CC3)N(C)C2)cc1 |
| InChI | InChI=1S/C26H32N4O6S/c1-27-16-23(37-18-20-5-9-22(35-2)10-6-20)15-24(27)25(31)28-11-13-29(14-12-28)26(32)36-17-19-3-7-21(8-4-19)30(33)34/h3-10,23-24H,11-18H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | GVRASEYAXMUHOS-ZEQRLZLVSA-N |
| XLogP | 3.39 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|