C27H34N4O6S — CID 67589284
(4-nitrophenyl)methyl 2-amino-2-[(3S)-1-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]acetate (PubChem CID 67589284) has the molecular formula C27H34N4O6S and a molecular weight of 542.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-amino-2-[(3S)-1-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-amino-2-[(3S)-1-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 67589284 |
| Molecular Formula | C27H34N4O6S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | (4-nitrophenyl)methyl 2-amino-2-[(3S)-1-[(2S,4S)-4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]acetate |
| SMILES | COc1ccc(CS[C@H]2C[C@@H](C(=O)N3CC[C@H](C(N)C(=O)OCc4ccc([N+](=O)[O-])cc4)C3)N(C)C2)cc1 |
| InChI | InChI=1S/C27H34N4O6S/c1-29-15-23(38-17-19-5-9-22(36-2)10-6-19)13-24(29)26(32)30-12-11-20(14-30)25(28)27(33)37-16-18-3-7-21(8-4-18)31(34)35/h3-10,20,23-25H,11-17,28H2,1-2H3/t20-,23-,24-,25?/m0/s1 |
| InChIKey | WKFXGUQDRICKDB-ZSSNFGTDSA-N |
| XLogP | 2.83 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|