C22H31N5O5S — CID 173304120
(4-nitrophenyl)methyl N-[1-(methylamino)-1-[(3R)-1-[(2S,4S)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]propan-2-ylidene]carbamate (PubChem CID 173304120) has the molecular formula C22H31N5O5S and a molecular weight of 477.59 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-(methylamino)-1-[(3R)-1-[(2S,4S)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]propan-2-ylidene]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-(methylamino)-1-[(3R)-1-[(2S,4S)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]propan-2-ylidene]carbamate |
|---|---|
| PubChem CID | 173304120 |
| Molecular Formula | C22H31N5O5S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-(methylamino)-1-[(3R)-1-[(2S,4S)-1-methyl-4-sulfanylpyrrolidine-2-carbonyl]pyrrolidin-3-yl]propan-2-ylidene]carbamate |
| SMILES | CNC(C(C)=NC(=O)OCc1ccc([N+](=O)[O-])cc1)[C@@H]1CCN(C(=O)[C@@H]2C[C@H](S)CN2C)C1 |
| InChI | InChI=1S/C22H31N5O5S/c1-14(24-22(29)32-13-15-4-6-17(7-5-15)27(30)31)20(23-2)16-8-9-26(11-16)21(28)19-10-18(33)12-25(19)3/h4-7,16,18-20,23,33H,8-13H2,1-3H3/t16-,18+,19+,20?/m1/s1 |
| InChIKey | VHWUTZCHSSQONH-VYLRAECFSA-N |
| XLogP | 2.13 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|