C28H32N6O9S — CID 57305624
(4-nitrophenyl)methyl (2S,4S)-2-[(3S)-3-[[[1-amino-3-[(4-nitrophenyl)methoxy]-3-oxopropylidene]amino]methyl]pyrrolidine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 57305624) has the molecular formula C28H32N6O9S and a molecular weight of 628.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[(3S)-3-[[[1-amino-3-[(4-nitrophenyl)methoxy]-3-oxopropylidene]amino]methyl]pyrrolidine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[(3S)-3-[[[1-amino-3-[(4-nitrophenyl)methoxy]-3-oxopropylidene]amino]methyl]pyrrolidine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57305624 |
| Molecular Formula | C28H32N6O9S |
| Molecular Weight | 628.66 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[(3S)-3-[[[1-amino-3-[(4-nitrophenyl)methoxy]-3-oxopropylidene]amino]methyl]pyrrolidine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | N/C(CC(=O)OCc1ccc([N+](=O)[O-])cc1)=N\C[C@@H]1CCN(C(=O)[C@@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C28H32N6O9S/c29-25(12-26(35)42-16-18-1-5-21(6-2-18)33(38)39)30-13-20-9-10-31(14-20)27(36)24-11-23(44)15-32(24)28(37)43-17-19-3-7-22(8-4-19)34(40)41/h1-8,20,23-24,44H,9-17H2,(H2,29,30)/t20-,23-,24-/m0/s1 |
| InChIKey | OEZGGHAGTDKMOA-OYDLWJJNSA-N |
| XLogP | 2.85 |
| TPSA | 200.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|