C28H32N6O9S — CID 139624617
(4-nitrophenyl)methyl (2S,4S)-2-[(2S)-2-methyl-4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 139624617) has the molecular formula C28H32N6O9S and a molecular weight of 628.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[(2S)-2-methyl-4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[(2S)-2-methyl-4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139624617 |
| Molecular Formula | C28H32N6O9S |
| Molecular Weight | 628.66 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[(2S)-2-methyl-4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(=NC(=O)OCc1ccc([N+](=O)[O-])cc1)N1CCN(C(=O)[C@@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@@H](C)C1 |
| InChI | InChI=1S/C28H32N6O9S/c1-18-14-30(19(2)29-27(36)42-16-20-3-7-22(8-4-20)33(38)39)11-12-31(18)26(35)25-13-24(44)15-32(25)28(37)43-17-21-5-9-23(10-6-21)34(40)41/h3-10,18,24-25,44H,11-17H2,1-2H3/t18-,24-,25-/m0/s1 |
| InChIKey | BMZOIJXXBMXPGX-WDNCENIBSA-N |
| XLogP | 3.80 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|