C16H19N3O6S — CID 56633635
methyl (2S,4S)-1-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-4-sulfanylpyrrolidine-2-carboxylate (PubChem CID 56633635) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is methyl (2S,4S)-1-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-4-sulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-4-sulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56633635 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl (2S,4S)-1-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-4-sulfanylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](S)CN1C(C)=NC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19N3O6S/c1-10(18-8-13(26)7-14(18)15(20)24-2)17-16(21)25-9-11-3-5-12(6-4-11)19(22)23/h3-6,13-14,26H,7-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | JDEZUHYYBJRGLM-KBPBESRZSA-N |
| XLogP | 2.20 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|