C28H32N6O9 — CID 173310486
(4-nitrophenyl)methyl 2-[4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 173310486) has the molecular formula C28H32N6O9 and a molecular weight of 596.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173310486 |
| Molecular Formula | C28H32N6O9 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[4-[C-methyl-N-[(4-nitrophenyl)methoxycarbonyl]carbonimidoyl]-1,4-diazepane-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=NC(=O)OCc1ccc([N+](=O)[O-])cc1)N1CCCN(C(=O)C2CCCN2C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H32N6O9/c1-20(29-27(36)42-18-21-5-9-23(10-6-21)33(38)39)30-13-3-14-31(17-16-30)26(35)25-4-2-15-32(25)28(37)43-19-22-7-11-24(12-8-22)34(40)41/h5-12,25H,2-4,13-19H2,1H3 |
| InChIKey | OLMFQGFLEXATNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 178.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|