C20H26N4O6S — CID 139665070
S-[(3S,5S)-1-methyl-5-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidine-1-carbonyl]pyrrolidin-3-yl] ethanethioate (PubChem CID 139665070) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is S-[(3S,5S)-1-methyl-5-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidine-1-carbonyl]pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3S,5S)-1-methyl-5-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidine-1-carbonyl]pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 139665070 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | S-[(3S,5S)-1-methyl-5-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidine-1-carbonyl]pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1C[C@@H](C(=O)N2CC[C@@H](NC(=O)OCc3ccc([N+](=O)[O-])cc3)C2)N(C)C1 |
| InChI | InChI=1S/C20H26N4O6S/c1-13(25)31-17-9-18(22(2)11-17)19(26)23-8-7-15(10-23)21-20(27)30-12-14-3-5-16(6-4-14)24(28)29/h3-6,15,17-18H,7-12H2,1-2H3,(H,21,27)/t15-,17+,18+/m1/s1 |
| InChIKey | UPNTWCXFQHHZAF-NJAFHUGGSA-N |
| XLogP | 1.77 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|