C27H29N5O9S — CID 151205906
(4-nitrophenyl)methyl (2R,4S)-2-[(E)-3-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidin-1-yl]-3-oxoprop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 151205906) has the molecular formula C27H29N5O9S and a molecular weight of 599.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-2-[(E)-3-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidin-1-yl]-3-oxoprop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-2-[(E)-3-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidin-1-yl]-3-oxoprop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151205906 |
| Molecular Formula | C27H29N5O9S |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-2-[(E)-3-[(3R)-3-[(4-nitrophenyl)methoxycarbonylamino]pyrrolidin-1-yl]-3-oxoprop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | O=C(N[C@@H]1CCN(C(=O)/C=C/[C@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H29N5O9S/c33-25(29-12-11-20(14-29)28-26(34)40-16-18-1-5-21(6-2-18)31(36)37)10-9-23-13-24(42)15-30(23)27(35)41-17-19-3-7-22(8-4-19)32(38)39/h1-10,20,23-24,42H,11-17H2,(H,28,34)/b10-9+/t20-,23+,24+/m1/s1 |
| InChIKey | NJGPRIMJEZQYFA-NESZAOROSA-N |
| XLogP | 3.60 |
| TPSA | 174.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|