C15H19N3O4 — CID 67733624
(4-nitrophenyl)methyl N-(1-prop-2-enylpyrrolidin-3-yl)carbamate (PubChem CID 67733624) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-(1-prop-2-enylpyrrolidin-3-yl)carbamate.
| Compound Name | (4-nitrophenyl)methyl N-(1-prop-2-enylpyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 67733624 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (4-nitrophenyl)methyl N-(1-prop-2-enylpyrrolidin-3-yl)carbamate |
| SMILES | C=CCN1CCC(NC(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H19N3O4/c1-2-8-17-9-7-13(10-17)16-15(19)22-11-12-3-5-14(6-4-12)18(20)21/h2-6,13H,1,7-11H2,(H,16,19) |
| InChIKey | KFPJHFGBDTZFFN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|