C25H32ClN3O4 — CID 142246097
4-[(4-chlorophenyl)methyl]piperidine;(4-nitrophenyl)methyl N-cyclopentylcarbamate (PubChem CID 142246097) has the molecular formula C25H32ClN3O4 and a molecular weight of 474.00 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]piperidine;(4-nitrophenyl)methyl N-cyclopentylcarbamate.
| Compound Name | 4-[(4-chlorophenyl)methyl]piperidine;(4-nitrophenyl)methyl N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 142246097 |
| Molecular Formula | C25H32ClN3O4 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]piperidine;(4-nitrophenyl)methyl N-cyclopentylcarbamate |
| SMILES | Clc1ccc(CC2CCNCC2)cc1.O=C(NC1CCCC1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H16N2O4.C12H16ClN/c16-13(14-11-3-1-2-4-11)19-9-10-5-7-12(8-6-10)15(17)18;13-12-3-1-10(2-4-12)9-11-5-7-14-8-6-11/h5-8,11H,1-4,9H2,(H,14,16);1-4,11,14H,5-9H2 |
| InChIKey | SMUBTQOQNCOFOI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|