C18H24N2O4 — CID 162785494
(4-nitrophenyl)methyl N-[(1R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 162785494) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[(1R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[(1R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 162785494 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (4-nitrophenyl)methyl N-[(1R,3R,4S)-3-propan-2-yl-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CC(C)[C@H]1C(NC(=O)OCc2ccc([N+](=O)[O-])cc2)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H24N2O4/c1-11(2)16-13-5-6-14(9-13)17(16)19-18(21)24-10-12-3-7-15(8-4-12)20(22)23/h3-4,7-8,11,13-14,16-17H,5-6,9-10H2,1-2H3,(H,19,21)/t13-,14+,16+,17?/m0/s1 |
| InChIKey | VOMRRQHYXJGEPL-QFNOMPFUSA-N |
| XLogP | 3.89 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|