C14H17N3O6 — CID 54172781
(4-nitrophenyl)methyl N-[(2R,3R)-2-[(2R)-1-hydroxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate (PubChem CID 54172781) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[(2R,3R)-2-[(2R)-1-hydroxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[(2R,3R)-2-[(2R)-1-hydroxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 54172781 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (4-nitrophenyl)methyl N-[(2R,3R)-2-[(2R)-1-hydroxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate |
| SMILES | C[C@@H](CO)[C@H]1NC(=O)[C@@H]1NC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O6/c1-8(6-18)11-12(13(19)15-11)16-14(20)23-7-9-2-4-10(5-3-9)17(21)22/h2-5,8,11-12,18H,6-7H2,1H3,(H,15,19)(H,16,20)/t8-,11+,12+/m0/s1 |
| InChIKey | OWENARZSQQLSKO-XXILOJSOSA-N |
| XLogP | 0.32 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|