C21H23N5O7S — CID 22242830
(4-nitrophenyl)methyl 3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-oxazole-4-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 22242830) has the molecular formula C21H23N5O7S and a molecular weight of 489.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-oxazole-4-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-oxazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22242830 |
| Molecular Formula | C21H23N5O7S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[[2-(3-acetylsulfanylazetidin-1-yl)-1,3-oxazole-4-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)SC1CN(c2nc(C(=O)NC3CCN(C(=O)OCc4ccc([N+](=O)[O-])cc4)C3)co2)C1 |
| InChI | InChI=1S/C21H23N5O7S/c1-13(27)34-17-9-25(10-17)20-23-18(12-32-20)19(28)22-15-6-7-24(8-15)21(29)33-11-14-2-4-16(5-3-14)26(30)31/h2-5,12,15,17H,6-11H2,1H3,(H,22,28) |
| InChIKey | CKLNMUWBRBKAQM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 148.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|